C16H16F2N4O5S — CID 9278743
2-[(2,6-difluorophenyl)sulfonylamino]-N-[2-(2-nitroanilino)ethyl]acetamide (PubChem CID 9278743) has the molecular formula C16H16F2N4O5S and a molecular weight of 414.39 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)sulfonylamino]-N-[2-(2-nitroanilino)ethyl]acetamide.
| Compound Name | 2-[(2,6-difluorophenyl)sulfonylamino]-N-[2-(2-nitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 9278743 |
| Molecular Formula | C16H16F2N4O5S |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-[(2,6-difluorophenyl)sulfonylamino]-N-[2-(2-nitroanilino)ethyl]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1c(F)cccc1F)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16F2N4O5S/c17-11-4-3-5-12(18)16(11)28(26,27)21-10-15(23)20-9-8-19-13-6-1-2-7-14(13)22(24)25/h1-7,19,21H,8-10H2,(H,20,23) |
| InChIKey | AVZNZSOLIOHHHC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|