C15H23ClN4O3 — CID 120574846
N-(2-methylpiperidin-3-yl)-3-(2-nitroanilino)propanamide;hydrochloride (PubChem CID 120574846) has the molecular formula C15H23ClN4O3 and a molecular weight of 342.83 g/mol. Its IUPAC name is N-(2-methylpiperidin-3-yl)-3-(2-nitroanilino)propanamide;hydrochloride.
| Compound Name | N-(2-methylpiperidin-3-yl)-3-(2-nitroanilino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120574846 |
| Molecular Formula | C15H23ClN4O3 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-(2-methylpiperidin-3-yl)-3-(2-nitroanilino)propanamide;hydrochloride |
| SMILES | CC1NCCCC1NC(=O)CCNc1ccccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H22N4O3.ClH/c1-11-12(6-4-9-16-11)18-15(20)8-10-17-13-5-2-3-7-14(13)19(21)22;/h2-3,5,7,11-12,16-17H,4,6,8-10H2,1H3,(H,18,20);1H |
| InChIKey | ATWHYRGRHOJEHB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|