C19H24N6O5 — CID 51963253
methyl 1-[(1R,2R)-2-[3-(2-nitroanilino)propanoylamino]cyclohexyl]triazole-4-carboxylate (PubChem CID 51963253) has the molecular formula C19H24N6O5 and a molecular weight of 416.44 g/mol. Its IUPAC name is methyl 1-[(1R,2R)-2-[3-(2-nitroanilino)propanoylamino]cyclohexyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(1R,2R)-2-[3-(2-nitroanilino)propanoylamino]cyclohexyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 51963253 |
| Molecular Formula | C19H24N6O5 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | methyl 1-[(1R,2R)-2-[3-(2-nitroanilino)propanoylamino]cyclohexyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@@H]2CCCC[C@H]2NC(=O)CCNc2ccccc2[N+](=O)[O-])nn1 |
| InChI | InChI=1S/C19H24N6O5/c1-30-19(27)15-12-24(23-22-15)16-8-4-3-7-14(16)21-18(26)10-11-20-13-6-2-5-9-17(13)25(28)29/h2,5-6,9,12,14,16,20H,3-4,7-8,10-11H2,1H3,(H,21,26)/t14-,16-/m1/s1 |
| InChIKey | FFRUZYFDYVYAKP-GDBMZVCRSA-N |
| XLogP | 2.08 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|