C16H21F3N2O — CID 8550278
2-[cyclohexylmethyl(methyl)amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 8550278) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-[cyclohexylmethyl(methyl)amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[cyclohexylmethyl(methyl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 8550278 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[cyclohexylmethyl(methyl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)CC1CCCCC1 |
| InChI | InChI=1S/C16H21F3N2O/c1-21(9-11-5-3-2-4-6-11)10-14(22)20-13-8-7-12(17)15(18)16(13)19/h7-8,11H,2-6,9-10H2,1H3,(H,20,22) |
| InChIKey | AZCXYTSJFVBJSM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|