C15H21ClFN3O — CID 79702201
N-(4-chloro-2-fluorophenyl)-2-[methyl(piperidin-4-ylmethyl)amino]acetamide (PubChem CID 79702201) has the molecular formula C15H21ClFN3O and a molecular weight of 313.80 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[methyl(piperidin-4-ylmethyl)amino]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[methyl(piperidin-4-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 79702201 |
| Molecular Formula | C15H21ClFN3O |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[methyl(piperidin-4-ylmethyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)cc1F)CC1CCNCC1 |
| InChI | InChI=1S/C15H21ClFN3O/c1-20(9-11-4-6-18-7-5-11)10-15(21)19-14-3-2-12(16)8-13(14)17/h2-3,8,11,18H,4-7,9-10H2,1H3,(H,19,21) |
| InChIKey | VOOGYXHQCHGBEE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |