C17H21F3N3O4+ — CID 8741883
methyl 1-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8741883) has the molecular formula C17H21F3N3O4+ and a molecular weight of 388.37 g/mol. Its IUPAC name is methyl 1-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8741883 |
| Molecular Formula | C17H21F3N3O4+ |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | methyl 1-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+](CC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C17H20F3N3O4/c1-27-17(26)10-4-6-23(7-5-10)9-14(25)21-8-13(24)22-12-3-2-11(18)15(19)16(12)20/h2-3,10H,4-9H2,1H3,(H,21,25)(H,22,24)/p+1 |
| InChIKey | SNBLYWICFRNHGV-UHFFFAOYSA-O |
| XLogP | -0.37 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|