C21H23F3N3O3+ — CID 8770486
cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium (PubChem CID 8770486) has the molecular formula C21H23F3N3O3+ and a molecular weight of 422.43 g/mol. Its IUPAC name is cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium.
| Compound Name | cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8770486 |
| Molecular Formula | C21H23F3N3O3+ |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium |
| SMILES | COc1ccc(C[NH+](CC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)C2CC2)cc1 |
| InChI | InChI=1S/C21H22F3N3O3/c1-30-15-6-2-13(3-7-15)11-27(14-4-5-14)12-19(29)25-10-18(28)26-17-9-8-16(22)20(23)21(17)24/h2-3,6-9,14H,4-5,10-12H2,1H3,(H,25,29)(H,26,28)/p+1 |
| InChIKey | KJJWEJZCNWXJKC-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|