C25H27N2O2+ — CID 8770300
cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium (PubChem CID 8770300) has the molecular formula C25H27N2O2+ and a molecular weight of 387.50 g/mol. Its IUPAC name is cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium.
| Compound Name | cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8770300 |
| Molecular Formula | C25H27N2O2+ |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
| SMILES | COc1ccc(C[NH+](CC(=O)Nc2ccccc2-c2ccccc2)C2CC2)cc1 |
| InChI | InChI=1S/C25H26N2O2/c1-29-22-15-11-19(12-16-22)17-27(21-13-14-21)18-25(28)26-24-10-6-5-9-23(24)20-7-3-2-4-8-20/h2-12,15-16,21H,13-14,17-18H2,1H3,(H,26,28)/p+1 |
| InChIKey | XRDRKENCSFVXKZ-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |