C20H24F3N3O2+2 — CID 9130005
2-[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 9130005) has the molecular formula C20H24F3N3O2+2 and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 9130005 |
| Molecular Formula | C20H24F3N3O2+2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | COc1ccc(C[NH+]2CC[NH+](CC(=O)Nc3ccc(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-28-15-4-2-14(3-5-15)12-25-8-10-26(11-9-25)13-18(27)24-17-7-6-16(21)19(22)20(17)23/h2-7H,8-13H2,1H3,(H,24,27)/p+2 |
| InChIKey | YIZWGYINIUGVTQ-UHFFFAOYSA-P |
| XLogP | 0.03 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|