C18H31N3O2+2 — CID 9130146
N-butyl-2-[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]acetamide (PubChem CID 9130146) has the molecular formula C18H31N3O2+2 and a molecular weight of 321.47 g/mol. Its IUPAC name is N-butyl-2-[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]acetamide |
|---|---|
| PubChem CID | 9130146 |
| Molecular Formula | C18H31N3O2+2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | N-butyl-2-[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]acetamide |
| SMILES | CCCCNC(=O)C[NH+]1CC[NH+](Cc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C18H29N3O2/c1-3-4-9-19-18(22)15-21-12-10-20(11-13-21)14-16-5-7-17(23-2)8-6-16/h5-8H,3-4,9-15H2,1-2H3,(H,19,22)/p+2 |
| InChIKey | GDQKHIKCPJMMKG-UHFFFAOYSA-P |
| XLogP | -1.11 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|