C19H31N2O4+ — CID 7436223
N-(3-ethoxypropyl)-2-[4-hydroxy-4-(4-methoxyphenyl)piperidin-1-ium-1-yl]acetamide (PubChem CID 7436223) has the molecular formula C19H31N2O4+ and a molecular weight of 351.47 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[4-hydroxy-4-(4-methoxyphenyl)piperidin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-[4-hydroxy-4-(4-methoxyphenyl)piperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 7436223 |
| Molecular Formula | C19H31N2O4+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[4-hydroxy-4-(4-methoxyphenyl)piperidin-1-ium-1-yl]acetamide |
| SMILES | CCOCCCNC(=O)C[NH+]1CCC(O)(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C19H30N2O4/c1-3-25-14-4-11-20-18(22)15-21-12-9-19(23,10-13-21)16-5-7-17(24-2)8-6-16/h5-8,23H,3-4,9-15H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | HBUQBEVNSQFQPU-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|