C23H39IN4O3 — CID 110927875
2-cyclopentyl-N-[2-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 110927875) has the molecular formula C23H39IN4O3 and a molecular weight of 546.49 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-cyclopentyl-N-[2-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110927875 |
| Molecular Formula | C23H39IN4O3 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 2-cyclopentyl-N-[2-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC)cc1)NCCNC(=O)CC1CCCC1.I |
| InChI | InChI=1S/C23H38N4O3.HI/c1-3-30-16-6-13-25-23(27-18-20-9-11-21(29-2)12-10-20)26-15-14-24-22(28)17-19-7-4-5-8-19;/h9-12,19H,3-8,13-18H2,1-2H3,(H,24,28)(H2,25,26,27);1H |
| InChIKey | FYISJTXIBJZBIK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|