C20H35IN4O3 — CID 110913327
3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 110913327) has the molecular formula C20H35IN4O3 and a molecular weight of 506.43 g/mol. Its IUPAC name is 3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 110913327 |
| Molecular Formula | C20H35IN4O3 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC)cc1)NCCC(=O)NC(C)C.I |
| InChI | InChI=1S/C20H34N4O3.HI/c1-5-27-14-6-12-21-20(22-13-11-19(25)24-16(2)3)23-15-17-7-9-18(26-4)10-8-17;/h7-10,16H,5-6,11-15H2,1-4H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | DWCHFMYRHGAJOR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|