C18H33IN4O4S — CID 110925238
1-(3-ethoxypropyl)-3-[3-(methanesulfonamido)propyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 110925238) has the molecular formula C18H33IN4O4S and a molecular weight of 528.46 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[3-(methanesulfonamido)propyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxypropyl)-3-[3-(methanesulfonamido)propyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110925238 |
| Molecular Formula | C18H33IN4O4S |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[3-(methanesulfonamido)propyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC)cc1)NCCCNS(C)(=O)=O.I |
| InChI | InChI=1S/C18H32N4O4S.HI/c1-4-26-14-6-12-20-18(19-11-5-13-22-27(3,23)24)21-15-16-7-9-17(25-2)10-8-16;/h7-10,22H,4-6,11-15H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | IWEXGGUYHFSDQM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|