C19H35IN4O4S — CID 111112009
1-(3-ethoxypropyl)-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111112009) has the molecular formula C19H35IN4O4S and a molecular weight of 542.48 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxypropyl)-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111112009 |
| Molecular Formula | C19H35IN4O4S |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC)cc1)NCC(C)(C)NS(C)(=O)=O.I |
| InChI | InChI=1S/C19H34N4O4S.HI/c1-6-27-13-7-12-20-18(22-15-19(2,3)23-28(5,24)25)21-14-16-8-10-17(26-4)11-9-16;/h8-11,23H,6-7,12-15H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | FONBPLWHZIVEGU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|