C23H34IN5O3 — CID 110927801
3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 110927801) has the molecular formula C23H34IN5O3 and a molecular weight of 555.46 g/mol. Its IUPAC name is 3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 110927801 |
| Molecular Formula | C23H34IN5O3 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | 3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC)cc1)NCCC(=O)Nc1ccc(C)cn1.I |
| InChI | InChI=1S/C23H33N5O3.HI/c1-4-31-15-5-13-24-23(27-17-19-7-9-20(30-3)10-8-19)25-14-12-22(29)28-21-11-6-18(2)16-26-21;/h6-11,16H,4-5,12-15,17H2,1-3H3,(H2,24,25,27)(H,26,28,29);1H |
| InChIKey | SLEIRBIZJSELBW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|