C18H32IN5O3 — CID 111406446
3-[[N-ethyl-N'-[3-(2-methoxyethoxy)propyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 111406446) has the molecular formula C18H32IN5O3 and a molecular weight of 493.39 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[3-(2-methoxyethoxy)propyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-[3-(2-methoxyethoxy)propyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111406446 |
| Molecular Formula | C18H32IN5O3 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 3-[[N-ethyl-N'-[3-(2-methoxyethoxy)propyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCCOC)NCCC(=O)Nc1ccc(C)cn1.I |
| InChI | InChI=1S/C18H31N5O3.HI/c1-4-19-18(20-9-5-11-26-13-12-25-3)21-10-8-17(24)23-16-7-6-15(2)14-22-16;/h6-7,14H,4-5,8-13H2,1-3H3,(H2,19,20,21)(H,22,23,24);1H |
| InChIKey | NLZRCWDGFSRHOQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|