C16H27N5O2 — CID 110974911
3-[[N-ethyl-N'-(3-methoxypropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 110974911) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-(3-methoxypropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N-ethyl-N'-(3-methoxypropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 110974911 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 3-[[N-ethyl-N'-(3-methoxypropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | CCN/C(=N\CCCOC)NCCC(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C16H27N5O2/c1-4-17-16(18-9-5-11-23-3)19-10-8-15(22)21-14-7-6-13(2)12-20-14/h6-7,12H,4-5,8-11H2,1-3H3,(H2,17,18,19)(H,20,21,22) |
| InChIKey | HMFLNTRNUYYNJP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|