C22H31N5O3 — CID 111213833
3-[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 111213833) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 111213833 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 3-[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | CCN/C(=N\CCC(=O)Nc1ccc(C)cn1)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H31N5O3/c1-5-23-22(24-12-10-17-7-8-18(29-3)19(14-17)30-4)25-13-11-21(28)27-20-9-6-16(2)15-26-20/h6-9,14-15H,5,10-13H2,1-4H3,(H2,23,24,25)(H,26,27,28) |
| InChIKey | WQBKOLLRGRZGET-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|