C15H26IN5O — CID 111126583
3-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 111126583) has the molecular formula C15H26IN5O and a molecular weight of 419.31 g/mol. Its IUPAC name is 3-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111126583 |
| Molecular Formula | C15H26IN5O |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)Nc1ccc(C)cn1)NC(C)C.I |
| InChI | InChI=1S/C15H25N5O.HI/c1-5-16-15(19-11(2)3)17-9-8-14(21)20-13-7-6-12(4)10-18-13;/h6-7,10-11H,5,8-9H2,1-4H3,(H2,16,17,19)(H,18,20,21);1H |
| InChIKey | FMELXPGCXLZAJM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|