C22H29IN6O — CID 110996264
3-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 110996264) has the molecular formula C22H29IN6O and a molecular weight of 520.42 g/mol. Its IUPAC name is 3-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 110996264 |
| Molecular Formula | C22H29IN6O |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 3-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)Nc1ccc(C)cn1)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C22H28N6O.HI/c1-3-23-22(24-12-10-17-15-26-19-7-5-4-6-18(17)19)25-13-11-21(29)28-20-9-8-16(2)14-27-20;/h4-9,14-15,26H,3,10-13H2,1-2H3,(H2,23,24,25)(H,27,28,29);1H |
| InChIKey | PYEWROXCWBZBRX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|