C21H33IN4O2 — CID 110997170
methyl 7-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate;hydroiodide (PubChem CID 110997170) has the molecular formula C21H33IN4O2 and a molecular weight of 500.43 g/mol. Its IUPAC name is methyl 7-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate;hydroiodide.
| Compound Name | methyl 7-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 110997170 |
| Molecular Formula | C21H33IN4O2 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | methyl 7-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate;hydroiodide |
| SMILES | CCN/C(=N\CCCCCCC(=O)OC)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C21H32N4O2.HI/c1-3-22-21(23-14-9-5-4-6-12-20(26)27-2)24-15-13-17-16-25-19-11-8-7-10-18(17)19;/h7-8,10-11,16,25H,3-6,9,12-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | UKCGNJBCCYXNES-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|