C19H32N6O2 — CID 110972225
3-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 110972225) has the molecular formula C19H32N6O2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 110972225 |
| Molecular Formula | C19H32N6O2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 3-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | CCN/C(=N\CCCN1CCOCC1)NCCC(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C19H32N6O2/c1-3-20-19(21-8-4-10-25-11-13-27-14-12-25)22-9-7-18(26)24-17-6-5-16(2)15-23-17/h5-6,15H,3-4,7-14H2,1-2H3,(H2,20,21,22)(H,23,24,26) |
| InChIKey | LZAZEGLXGHQGMN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|