C20H34N6O2 — CID 111314182
3-[[N-ethyl-N'-(2-methyl-2-morpholin-4-ylpropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 111314182) has the molecular formula C20H34N6O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-(2-methyl-2-morpholin-4-ylpropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N-ethyl-N'-(2-methyl-2-morpholin-4-ylpropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 111314182 |
| Molecular Formula | C20H34N6O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 3-[[N-ethyl-N'-(2-methyl-2-morpholin-4-ylpropyl)carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCOCC1)NCCC(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C20H34N6O2/c1-5-21-19(24-15-20(3,4)26-10-12-28-13-11-26)22-9-8-18(27)25-17-7-6-16(2)14-23-17/h6-7,14H,5,8-13,15H2,1-4H3,(H2,21,22,24)(H,23,25,27) |
| InChIKey | OTJHWMVTYNXEAC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|