C22H35IN6O — CID 111313175
1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide (PubChem CID 111313175) has the molecular formula C22H35IN6O and a molecular weight of 526.47 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111313175 |
| Molecular Formula | C22H35IN6O |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCOCC1)NCCNc1ccc2ccccc2n1.I |
| InChI | InChI=1S/C22H34N6O.HI/c1-4-23-21(26-17-22(2,3)28-13-15-29-16-14-28)25-12-11-24-20-10-9-18-7-5-6-8-19(18)27-20;/h5-10H,4,11-17H2,1-3H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | GASKTHZZEDWQMB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|