C19H33IN6O3 — CID 111314311
1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 111314311) has the molecular formula C19H33IN6O3 and a molecular weight of 520.42 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111314311 |
| Molecular Formula | C19H33IN6O3 |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCOCC1)NCCNc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C19H32N6O3.HI/c1-4-20-18(23-15-19(2,3)24-11-13-28-14-12-24)22-10-9-21-16-5-7-17(8-6-16)25(26)27;/h5-8,21H,4,9-15H2,1-3H3,(H2,20,22,23);1H |
| InChIKey | KUZKWOZZBXTFRH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|