C17H26N6O3 — CID 111929025
1-ethyl-3-[2-(4-nitroanilino)ethyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111929025) has the molecular formula C17H26N6O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-nitroanilino)ethyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(4-nitroanilino)ethyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111929025 |
| Molecular Formula | C17H26N6O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-ethyl-3-[2-(4-nitroanilino)ethyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCCC1)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H26N6O3/c1-2-18-17(21-13-16(24)22-11-3-4-12-22)20-10-9-19-14-5-7-15(8-6-14)23(25)26/h5-8,19H,2-4,9-13H2,1H3,(H2,18,20,21) |
| InChIKey | PVOAOHQZKLVWML-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|