C16H31IN6O — CID 111315275
1-ethyl-3-(2-imidazol-1-ylethyl)-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111315275) has the molecular formula C16H31IN6O and a molecular weight of 450.37 g/mol. Its IUPAC name is 1-ethyl-3-(2-imidazol-1-ylethyl)-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-imidazol-1-ylethyl)-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111315275 |
| Molecular Formula | C16H31IN6O |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1-ethyl-3-(2-imidazol-1-ylethyl)-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCOCC1)NCCn1ccnc1.I |
| InChI | InChI=1S/C16H30N6O.HI/c1-4-18-15(19-6-8-21-7-5-17-14-21)20-13-16(2,3)22-9-11-23-12-10-22;/h5,7,14H,4,6,8-13H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | KETVUWVNYYAQAT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|