C16H30N6O3 — CID 111830305
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111830305) has the molecular formula C16H30N6O3 and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111830305 |
| Molecular Formula | C16H30N6O3 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)N1CCOCC1)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C16H30N6O3/c1-4-17-14(18-5-6-22-13(23)11-19-15(22)24)20-12-16(2,3)21-7-9-25-10-8-21/h4-12H2,1-3H3,(H,19,24)(H2,17,18,20) |
| InChIKey | NDWWYCMQCIHFDH-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|