C20H31IN6O — CID 111187072
1-ethyl-2-(2-morpholin-4-ylethyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide (PubChem CID 111187072) has the molecular formula C20H31IN6O and a molecular weight of 498.41 g/mol. Its IUPAC name is 1-ethyl-2-(2-morpholin-4-ylethyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-morpholin-4-ylethyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111187072 |
| Molecular Formula | C20H31IN6O |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 1-ethyl-2-(2-morpholin-4-ylethyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCOCC1)NCCNc1ccc2ccccc2n1.I |
| InChI | InChI=1S/C20H30N6O.HI/c1-2-21-20(24-11-12-26-13-15-27-16-14-26)23-10-9-22-19-8-7-17-5-3-4-6-18(17)25-19;/h3-8H,2,9-16H2,1H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | PNKNPGXWBYZWSR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|