C16H23N5 — CID 110926423
1,3-diethyl-2-[2-(quinolin-2-ylamino)ethyl]guanidine (PubChem CID 110926423) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-(quinolin-2-ylamino)ethyl]guanidine.
| Compound Name | 1,3-diethyl-2-[2-(quinolin-2-ylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 110926423 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 1,3-diethyl-2-[2-(quinolin-2-ylamino)ethyl]guanidine |
| SMILES | CCNC(=NCCNc1ccc2ccccc2n1)NCC |
| InChI | InChI=1S/C16H23N5/c1-3-17-16(18-4-2)20-12-11-19-15-10-9-13-7-5-6-8-14(13)21-15/h5-10H,3-4,11-12H2,1-2H3,(H,19,21)(H2,17,18,20) |
| InChIKey | DMXVCWJOGDKGFO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|