C16H24IN5 — CID 111079534
1-tert-butyl-2-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide (PubChem CID 111079534) has the molecular formula C16H24IN5 and a molecular weight of 413.31 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111079534 |
| Molecular Formula | C16H24IN5 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-tert-butyl-2-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
| SMILES | CC(C)(C)N/C(N)=N/CCNc1ccc2ccccc2n1.I |
| InChI | InChI=1S/C16H23N5.HI/c1-16(2,3)21-15(17)19-11-10-18-14-9-8-12-6-4-5-7-13(12)20-14;/h4-9H,10-11H2,1-3H3,(H,18,20)(H3,17,19,21);1H |
| InChIKey | PUXGLNAURBNRJQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|