C14H17N3O — CID 113224831
2,2-dimethyl-3-(quinolin-2-ylamino)propanamide (PubChem CID 113224831) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 2,2-dimethyl-3-(quinolin-2-ylamino)propanamide.
| Compound Name | 2,2-dimethyl-3-(quinolin-2-ylamino)propanamide |
|---|---|
| PubChem CID | 113224831 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2,2-dimethyl-3-(quinolin-2-ylamino)propanamide |
| SMILES | CC(C)(CNc1ccc2ccccc2n1)C(N)=O |
| InChI | InChI=1S/C14H17N3O/c1-14(2,13(15)18)9-16-12-8-7-10-5-3-4-6-11(10)17-12/h3-8H,9H2,1-2H3,(H2,15,18)(H,16,17) |
| InChIKey | BDBGVUJSHOVRQP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |