C9H13ClN4O — CID 103761458
3-[(2-chloropyrimidin-4-yl)amino]-2,2-dimethylpropanamide (PubChem CID 103761458) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 3-[(2-chloropyrimidin-4-yl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(2-chloropyrimidin-4-yl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 103761458 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-[(2-chloropyrimidin-4-yl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNc1ccnc(Cl)n1)C(N)=O |
| InChI | InChI=1S/C9H13ClN4O/c1-9(2,7(11)15)5-13-6-3-4-12-8(10)14-6/h3-4H,5H2,1-2H3,(H2,11,15)(H,12,13,14) |
| InChIKey | YDXVBVLCTKKVJD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |