C8H10ClN3O2 — CID 62342073
ethyl 2-[(2-chloropyrimidin-4-yl)amino]acetate (PubChem CID 62342073) has the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. Its IUPAC name is ethyl 2-[(2-chloropyrimidin-4-yl)amino]acetate.
| Compound Name | ethyl 2-[(2-chloropyrimidin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 62342073 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | ethyl 2-[(2-chloropyrimidin-4-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1ccnc(Cl)n1 |
| InChI | InChI=1S/C8H10ClN3O2/c1-2-14-7(13)5-11-6-3-4-10-8(9)12-6/h3-4H,2,5H2,1H3,(H,10,11,12) |
| InChIKey | XWLADXUCCDKODK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |