C9H10Br2N2O2 — CID 167740848
ethyl 2-[(5,6-dibromo-2-pyridinyl)amino]acetate (PubChem CID 167740848) has the molecular formula C9H10Br2N2O2 and a molecular weight of 338.00 g/mol. Its IUPAC name is ethyl 2-[(5,6-dibromo-2-pyridinyl)amino]acetate.
| Compound Name | ethyl 2-[(5,6-dibromo-2-pyridinyl)amino]acetate |
|---|---|
| PubChem CID | 167740848 |
| Molecular Formula | C9H10Br2N2O2 |
| Molecular Weight | 338.00 g/mol |
| Exact Mass | 335.91 |
| IUPAC Name | ethyl 2-[(5,6-dibromo-2-pyridinyl)amino]acetate |
| SMILES | CCOC(=O)CNc1ccc(Br)c(Br)n1 |
| InChI | InChI=1S/C9H10Br2N2O2/c1-2-15-8(14)5-12-7-4-3-6(10)9(11)13-7/h3-4H,2,5H2,1H3,(H,12,13) |
| InChIKey | YOZZENZSRUZSOI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.00 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|