C11H17ClN4O — CID 115695349
3-[(2-chloropyrimidin-4-yl)amino]-N,N-diethylpropanamide (PubChem CID 115695349) has the molecular formula C11H17ClN4O and a molecular weight of 256.74 g/mol. Its IUPAC name is 3-[(2-chloropyrimidin-4-yl)amino]-N,N-diethylpropanamide.
| Compound Name | 3-[(2-chloropyrimidin-4-yl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 115695349 |
| Molecular Formula | C11H17ClN4O |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-[(2-chloropyrimidin-4-yl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNc1ccnc(Cl)n1 |
| InChI | InChI=1S/C11H17ClN4O/c1-3-16(4-2)10(17)6-8-13-9-5-7-14-11(12)15-9/h5,7H,3-4,6,8H2,1-2H3,(H,13,14,15) |
| InChIKey | DQSXWTRUXRKSJP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |