C6H5Cl2N3O — CID 116794848
2-chloro-N-(2-chloropyrimidin-4-yl)acetamide (PubChem CID 116794848) has the molecular formula C6H5Cl2N3O and a molecular weight of 206.03 g/mol. Its IUPAC name is 2-chloro-N-(2-chloropyrimidin-4-yl)acetamide.
| Compound Name | 2-chloro-N-(2-chloropyrimidin-4-yl)acetamide |
|---|---|
| PubChem CID | 116794848 |
| Molecular Formula | C6H5Cl2N3O |
| Molecular Weight | 206.03 g/mol |
| Exact Mass | 204.98 |
| IUPAC Name | 2-chloro-N-(2-chloropyrimidin-4-yl)acetamide |
| SMILES | O=C(CCl)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C6H5Cl2N3O/c7-3-5(12)10-4-1-2-9-6(8)11-4/h1-2H,3H2,(H,9,10,11,12) |
| InChIKey | XDBYXYHEELWIMH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.03 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|