C8H11ClN4O — CID 116795042
N-(2-chloropyrimidin-4-yl)-3-(methylamino)propanamide (PubChem CID 116795042) has the molecular formula C8H11ClN4O and a molecular weight of 214.66 g/mol. Its IUPAC name is N-(2-chloropyrimidin-4-yl)-3-(methylamino)propanamide.
| Compound Name | N-(2-chloropyrimidin-4-yl)-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 116795042 |
| Molecular Formula | C8H11ClN4O |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | N-(2-chloropyrimidin-4-yl)-3-(methylamino)propanamide |
| SMILES | CNCCC(=O)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C8H11ClN4O/c1-10-4-3-7(14)12-6-2-5-11-8(9)13-6/h2,5,10H,3-4H2,1H3,(H,11,12,13,14) |
| InChIKey | XUUMGTZKHFQHAC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |