C16H21N3O2 — CID 106537734
N,N-diethyl-3-[(7-hydroxyisoquinolin-1-yl)amino]propanamide (PubChem CID 106537734) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N,N-diethyl-3-[(7-hydroxyisoquinolin-1-yl)amino]propanamide.
| Compound Name | N,N-diethyl-3-[(7-hydroxyisoquinolin-1-yl)amino]propanamide |
|---|---|
| PubChem CID | 106537734 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N,N-diethyl-3-[(7-hydroxyisoquinolin-1-yl)amino]propanamide |
| SMILES | CCN(CC)C(=O)CCNc1nccc2ccc(O)cc12 |
| InChI | InChI=1S/C16H21N3O2/c1-3-19(4-2)15(21)8-10-18-16-14-11-13(20)6-5-12(14)7-9-17-16/h5-7,9,11,20H,3-4,8,10H2,1-2H3,(H,17,18) |
| InChIKey | GESBPLSIMZXJQM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |