C12H15N3O3S — CID 106537595
N-[2-[(7-hydroxyisoquinolin-1-yl)amino]ethyl]methanesulfonamide (PubChem CID 106537595) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[2-[(7-hydroxyisoquinolin-1-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(7-hydroxyisoquinolin-1-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 106537595 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[2-[(7-hydroxyisoquinolin-1-yl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1nccc2ccc(O)cc12 |
| InChI | InChI=1S/C12H15N3O3S/c1-19(17,18)15-7-6-14-12-11-8-10(16)3-2-9(11)4-5-13-12/h2-5,8,15-16H,6-7H2,1H3,(H,13,14) |
| InChIKey | MPIRMWWIVIGKNB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|