C11H13N3O — CID 106539287
1-(2,2-dimethylhydrazinyl)isoquinolin-7-ol (PubChem CID 106539287) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-(2,2-dimethylhydrazinyl)isoquinolin-7-ol.
| Compound Name | 1-(2,2-dimethylhydrazinyl)isoquinolin-7-ol |
|---|---|
| PubChem CID | 106539287 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(2,2-dimethylhydrazinyl)isoquinolin-7-ol |
| SMILES | CN(C)Nc1nccc2ccc(O)cc12 |
| InChI | InChI=1S/C11H13N3O/c1-14(2)13-11-10-7-9(15)4-3-8(10)5-6-12-11/h3-7,15H,1-2H3,(H,12,13) |
| InChIKey | LAPMQHUSMRTQLU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|