C15H18N2O — CID 106539803
1-(1-cyclobutylethylamino)isoquinolin-7-ol (PubChem CID 106539803) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-(1-cyclobutylethylamino)isoquinolin-7-ol.
| Compound Name | 1-(1-cyclobutylethylamino)isoquinolin-7-ol |
|---|---|
| PubChem CID | 106539803 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-(1-cyclobutylethylamino)isoquinolin-7-ol |
| SMILES | CC(Nc1nccc2ccc(O)cc12)C1CCC1 |
| InChI | InChI=1S/C15H18N2O/c1-10(11-3-2-4-11)17-15-14-9-13(18)6-5-12(14)7-8-16-15/h5-11,18H,2-4H2,1H3,(H,16,17) |
| InChIKey | MCUXFMBMEABQQT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |