C12H14N2O3 — CID 106538911
2-[(7-hydroxyisoquinolin-1-yl)amino]propane-1,3-diol (PubChem CID 106538911) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[(7-hydroxyisoquinolin-1-yl)amino]propane-1,3-diol.
| Compound Name | 2-[(7-hydroxyisoquinolin-1-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 106538911 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[(7-hydroxyisoquinolin-1-yl)amino]propane-1,3-diol |
| SMILES | OCC(CO)Nc1nccc2ccc(O)cc12 |
| InChI | InChI=1S/C12H14N2O3/c15-6-9(7-16)14-12-11-5-10(17)2-1-8(11)3-4-13-12/h1-5,9,15-17H,6-7H2,(H,13,14) |
| InChIKey | SQPGMKXFMRJIEZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |