C14H16N2OS — CID 106539790
1-(thian-3-ylamino)isoquinolin-7-ol (PubChem CID 106539790) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-(thian-3-ylamino)isoquinolin-7-ol.
| Compound Name | 1-(thian-3-ylamino)isoquinolin-7-ol |
|---|---|
| PubChem CID | 106539790 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(thian-3-ylamino)isoquinolin-7-ol |
| SMILES | Oc1ccc2ccnc(NC3CCCSC3)c2c1 |
| InChI | InChI=1S/C14H16N2OS/c17-12-4-3-10-5-6-15-14(13(10)8-12)16-11-2-1-7-18-9-11/h3-6,8,11,17H,1-2,7,9H2,(H,15,16) |
| InChIKey | GKTQXBAJCDPFQW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |