C17H20N2O2 — CID 106538685
N-(1-cyclopentylethyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine (PubChem CID 106538685) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(1-cyclopentylethyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine.
| Compound Name | N-(1-cyclopentylethyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
|---|---|
| PubChem CID | 106538685 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-(1-cyclopentylethyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
| SMILES | CC(Nc1nccc2cc3c(cc12)OCO3)C1CCCC1 |
| InChI | InChI=1S/C17H20N2O2/c1-11(12-4-2-3-5-12)19-17-14-9-16-15(20-10-21-16)8-13(14)6-7-18-17/h6-9,11-12H,2-5,10H2,1H3,(H,18,19) |
| InChIKey | MJEXZYHMXAGLLX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |