C14H15N3O2 — CID 106540364
1-N-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)cyclobutane-1,3-diamine (PubChem CID 106540364) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-N-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 106540364 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-N-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)cyclobutane-1,3-diamine |
| SMILES | NC1CC(Nc2nccc3cc4c(cc23)OCO4)C1 |
| InChI | InChI=1S/C14H15N3O2/c15-9-4-10(5-9)17-14-11-6-13-12(18-7-19-13)3-8(11)1-2-16-14/h1-3,6,9-10H,4-5,7,15H2,(H,16,17) |
| InChIKey | VTKDRKFNHYMGMP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |