C14H12N2O2 — CID 106539479
N-but-2-ynyl-[1,3]dioxolo[4,5-g]isoquinolin-5-amine (PubChem CID 106539479) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-but-2-ynyl-[1,3]dioxolo[4,5-g]isoquinolin-5-amine.
| Compound Name | N-but-2-ynyl-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
|---|---|
| PubChem CID | 106539479 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-but-2-ynyl-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
| SMILES | CC#CCNc1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C14H12N2O2/c1-2-3-5-15-14-11-8-13-12(17-9-18-13)7-10(11)4-6-16-14/h4,6-8H,5,9H2,1H3,(H,15,16) |
| InChIKey | HSCDRVPGYSEVJG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|