C12H10N2O4 — CID 82571312
2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)acetic acid (PubChem CID 82571312) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)acetic acid.
| Compound Name | 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)acetic acid |
|---|---|
| PubChem CID | 82571312 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)acetic acid |
| SMILES | O=C(O)CNc1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C12H10N2O4/c15-11(16)5-14-12-8-4-10-9(17-6-18-10)3-7(8)1-2-13-12/h1-4H,5-6H2,(H,13,14)(H,15,16) |
| InChIKey | GCOUVMSDYXZCAV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |