C15H17N3O3 — CID 106238731
5-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)pentanamide (PubChem CID 106238731) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)pentanamide.
| Compound Name | 5-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)pentanamide |
|---|---|
| PubChem CID | 106238731 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 5-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)pentanamide |
| SMILES | NC(=O)CCCCNc1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C15H17N3O3/c16-14(19)3-1-2-5-17-15-11-8-13-12(20-9-21-13)7-10(11)4-6-18-15/h4,6-8H,1-3,5,9H2,(H2,16,19)(H,17,18) |
| InChIKey | ALOSPOQBWXLTNQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|